C16H22N2O4S — CID 6212937
(E)-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)but-2-enamide (PubChem CID 6212937) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is (E)-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)but-2-enamide.
| Compound Name | (E)-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 6212937 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (E)-N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccc(OC)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C16H22N2O4S/c1-3-7-16(19)17-13-8-9-14(22-2)15(12-13)23(20,21)18-10-5-4-6-11-18/h3,7-9,12H,4-6,10-11H2,1-2H3,(H,17,19)/b7-3+ |
| InChIKey | PFUMASKSCQYGNS-XVNBXDOJSA-N |
| XLogP | 2.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|