C22H23F3N2O4S — CID 4798388
N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 4798388) has the molecular formula C22H23F3N2O4S and a molecular weight of 468.50 g/mol. Its IUPAC name is N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4798388 |
| Molecular Formula | C22H23F3N2O4S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C=Cc2cccc(C(F)(F)F)c2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H23F3N2O4S/c1-31-19-10-9-18(15-20(19)32(29,30)27-12-3-2-4-13-27)26-21(28)11-8-16-6-5-7-17(14-16)22(23,24)25/h5-11,14-15H,2-4,12-13H2,1H3,(H,26,28) |
| InChIKey | MPBVJEQGXBDTEW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|