C21H21F3N2O5S — CID 42991753
(E)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 42991753) has the molecular formula C21H21F3N2O5S and a molecular weight of 470.47 g/mol. Its IUPAC name is (E)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 42991753 |
| Molecular Formula | C21H21F3N2O5S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (E)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2cccc(C(F)(F)F)c2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H21F3N2O5S/c1-30-18-7-6-17(14-19(18)32(28,29)26-9-11-31-12-10-26)25-20(27)8-5-15-3-2-4-16(13-15)21(22,23)24/h2-8,13-14H,9-12H2,1H3,(H,25,27)/b8-5+ |
| InChIKey | VZMOBXFFMHTVJH-VMPITWQZSA-N |
| XLogP | 3.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|