C23H25N3O7S — CID 4831078
3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 4831078) has the molecular formula C23H25N3O7S and a molecular weight of 487.53 g/mol. Its IUPAC name is 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4831078 |
| Molecular Formula | C23H25N3O7S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 3-[4-(cyanomethoxy)-3-methoxyphenyl]-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(OC)c(S(=O)(=O)N3CCOCC3)c2)ccc1OCC#N |
| InChI | InChI=1S/C23H25N3O7S/c1-30-20-7-5-18(16-22(20)34(28,29)26-10-13-32-14-11-26)25-23(27)8-4-17-3-6-19(33-12-9-24)21(15-17)31-2/h3-8,15-16H,10-14H2,1-2H3,(H,25,27) |
| InChIKey | SZWDERRTLSIFFU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 127.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|