C22H26N2O7S — CID 3403224
3-(2,5-dimethoxyphenyl)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 3403224) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | 3-(2,5-dimethoxyphenyl)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3403224 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(C=CC(=O)Nc2ccc(OC)c(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C22H26N2O7S/c1-28-18-6-8-19(29-2)16(14-18)4-9-22(25)23-17-5-7-20(30-3)21(15-17)32(26,27)24-10-12-31-13-11-24/h4-9,14-15H,10-13H2,1-3H3,(H,23,25) |
| InChIKey | IPWSGSZCJYBGEY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|