C25H29N3O5S — CID 75125064
N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 75125064) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 75125064 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2ccc(C)c(S(=O)(=O)N3CCCCCC3)c2)ccc1OCC#N |
| InChI | InChI=1S/C25H29N3O5S/c1-19-7-10-21(18-24(19)34(30,31)28-14-5-3-4-6-15-28)27-25(29)12-9-20-8-11-22(33-16-13-26)23(17-20)32-2/h7-12,17-18H,3-6,14-16H2,1-2H3,(H,27,29) |
| InChIKey | BIHZGLUZQZBWSF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|