C22H25FN2O4S — CID 26682263
(E)-N-(2-fluoro-5-methylphenyl)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide (PubChem CID 26682263) has the molecular formula C22H25FN2O4S and a molecular weight of 432.52 g/mol. Its IUPAC name is (E)-N-(2-fluoro-5-methylphenyl)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-fluoro-5-methylphenyl)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26682263 |
| Molecular Formula | C22H25FN2O4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (E)-N-(2-fluoro-5-methylphenyl)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cc(C)ccc2F)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H25FN2O4S/c1-16-6-9-18(23)19(14-16)24-22(26)11-8-17-7-10-20(29-2)21(15-17)30(27,28)25-12-4-3-5-13-25/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,24,26)/b11-8+ |
| InChIKey | GWUVIHVFIYXPCQ-DHZHZOJOSA-N |
| XLogP | 3.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|