C22H25FN2O4S — CID 16610205
(E)-N-[(2-fluorophenyl)methyl]-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide (PubChem CID 16610205) has the molecular formula C22H25FN2O4S and a molecular weight of 432.52 g/mol. Its IUPAC name is (E)-N-[(2-fluorophenyl)methyl]-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2-fluorophenyl)methyl]-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16610205 |
| Molecular Formula | C22H25FN2O4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | (E)-N-[(2-fluorophenyl)methyl]-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCc2ccccc2F)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H25FN2O4S/c1-29-20-11-9-17(15-21(20)30(27,28)25-13-5-2-6-14-25)10-12-22(26)24-16-18-7-3-4-8-19(18)23/h3-4,7-12,15H,2,5-6,13-14,16H2,1H3,(H,24,26)/b12-10+ |
| InChIKey | GNAFGCUIPMULCD-ZRDIBKRKSA-N |
| XLogP | 3.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|