C23H26N2O6S — CID 2094286
(E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide (PubChem CID 2094286) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2094286 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (E)-N-(1,3-benzodioxol-5-ylmethyl)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCc2ccc3c(c2)OCO3)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H26N2O6S/c1-29-20-9-5-17(14-22(20)32(27,28)25-11-3-2-4-12-25)7-10-23(26)24-15-18-6-8-19-21(13-18)31-16-30-19/h5-10,13-14H,2-4,11-12,15-16H2,1H3,(H,24,26)/b10-7+ |
| InChIKey | CWJUHUORIRXTCE-JXMROGBWSA-N |
| XLogP | 2.93 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|