C24H28N2O6S — CID 71904016
ethyl 2-[3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoylamino]benzoate (PubChem CID 71904016) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is ethyl 2-[3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoylamino]benzoate.
| Compound Name | ethyl 2-[3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 71904016 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | ethyl 2-[3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C=Cc1ccc(OC)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C24H28N2O6S/c1-3-32-24(28)19-9-5-6-10-20(19)25-23(27)14-12-18-11-13-21(31-2)22(17-18)33(29,30)26-15-7-4-8-16-26/h5-6,9-14,17H,3-4,7-8,15-16H2,1-2H3,(H,25,27) |
| InChIKey | DESDXSKYDGQLII-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|