C22H26FN2O2+ — CID 9143426
(E)-3-(3-fluoro-4-methoxyphenyl)-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 9143426) has the molecular formula C22H26FN2O2+ and a molecular weight of 369.46 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 9143426 |
| Molecular Formula | C22H26FN2O2+ |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCc2ccccc2C[NH+]2CCCC2)cc1F |
| InChI | InChI=1S/C22H25FN2O2/c1-27-21-10-8-17(14-20(21)23)9-11-22(26)24-15-18-6-2-3-7-19(18)16-25-12-4-5-13-25/h2-3,6-11,14H,4-5,12-13,15-16H2,1H3,(H,24,26)/p+1/b11-9+ |
| InChIKey | OXTMUFIYRSVXNI-PKNBQFBNSA-O |
| XLogP | 2.34 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|