C22H26FN2O+ — CID 8968951
(E)-3-(3-fluorophenyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide (PubChem CID 8968951) has the molecular formula C22H26FN2O+ and a molecular weight of 353.46 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 8968951 |
| Molecular Formula | C22H26FN2O+ |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(F)c1)NCc1ccccc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C22H25FN2O/c23-21-10-6-7-18(15-21)11-12-22(26)24-16-19-8-2-3-9-20(19)17-25-13-4-1-5-14-25/h2-3,6-12,15H,1,4-5,13-14,16-17H2,(H,24,26)/p+1/b12-11+ |
| InChIKey | FPKDKHZPDWICND-VAWYXSNFSA-O |
| XLogP | 2.72 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|