C25H33N2O4+ — CID 8969655
(E)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 8969655) has the molecular formula C25H33N2O4+ and a molecular weight of 425.55 g/mol. Its IUPAC name is (E)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8969655 |
| Molecular Formula | C25H33N2O4+ |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (E)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]-3-(2,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)NCc1ccccc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C25H32N2O4/c1-29-22-16-24(31-3)23(30-2)15-19(22)11-12-25(28)26-17-20-9-5-6-10-21(20)18-27-13-7-4-8-14-27/h5-6,9-12,15-16H,4,7-8,13-14,17-18H2,1-3H3,(H,26,28)/p+1/b12-11+ |
| InChIKey | ZVUJVBAIRAYBLA-VAWYXSNFSA-O |
| XLogP | 2.61 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|