C20H25N2O2+ — CID 9142461
3-methoxy-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 9142461) has the molecular formula C20H25N2O2+ and a molecular weight of 325.43 g/mol. Its IUPAC name is 3-methoxy-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 3-methoxy-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 9142461 |
| Molecular Formula | C20H25N2O2+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 3-methoxy-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | COc1cccc(C(=O)NCc2ccccc2C[NH+]2CCCC2)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-24-19-10-6-9-16(13-19)20(23)21-14-17-7-2-3-8-18(17)15-22-11-4-5-12-22/h2-3,6-10,13H,4-5,11-12,14-15H2,1H3,(H,21,23)/p+1 |
| InChIKey | ZEYXXCMOGGIHBA-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |