C24H27N2O2+ — CID 9142487
3-methoxy-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]naphthalene-2-carboxamide (PubChem CID 9142487) has the molecular formula C24H27N2O2+ and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-methoxy-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]naphthalene-2-carboxamide.
| Compound Name | 3-methoxy-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 9142487 |
| Molecular Formula | C24H27N2O2+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 3-methoxy-N-[[2-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methyl]naphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NCc1ccccc1C[NH+]1CCCC1 |
| InChI | InChI=1S/C24H26N2O2/c1-28-23-15-19-9-3-2-8-18(19)14-22(23)24(27)25-16-20-10-4-5-11-21(20)17-26-12-6-7-13-26/h2-5,8-11,14-15H,6-7,12-13,16-17H2,1H3,(H,25,27)/p+1 |
| InChIKey | UMFMPPBHDWEYEG-UHFFFAOYSA-O |
| XLogP | 2.96 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |