C21H26FN2O+ — CID 8810728
2-(2-fluorophenyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 8810728) has the molecular formula C21H26FN2O+ and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 8810728 |
| Molecular Formula | C21H26FN2O+ |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | O=C(Cc1ccccc1F)NCc1ccccc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C21H25FN2O/c22-20-11-5-4-8-17(20)14-21(25)23-15-18-9-2-3-10-19(18)16-24-12-6-1-7-13-24/h2-5,8-11H,1,6-7,12-16H2,(H,23,25)/p+1 |
| InChIKey | FWJPHTJJOQWQNB-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |