C22H29N2O3S+ — CID 8969170
3-(benzenesulfonyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]propanamide (PubChem CID 8969170) has the molecular formula C22H29N2O3S+ and a molecular weight of 401.55 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 8969170 |
| Molecular Formula | C22H29N2O3S+ |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-(benzenesulfonyl)-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)NCc1ccccc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C22H28N2O3S/c25-22(13-16-28(26,27)21-11-3-1-4-12-21)23-17-19-9-5-6-10-20(19)18-24-14-7-2-8-15-24/h1,3-6,9-12H,2,7-8,13-18H2,(H,23,25)/p+1 |
| InChIKey | UIBODDFQJVOMNJ-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |