C22H29N2OS+ — CID 8969492
2-(4-methylphenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 8969492) has the molecular formula C22H29N2OS+ and a molecular weight of 369.55 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-methylphenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 8969492 |
| Molecular Formula | C22H29N2OS+ |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-(4-methylphenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | Cc1ccc(SCC(=O)NCc2ccccc2C[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C22H28N2OS/c1-18-9-11-21(12-10-18)26-17-22(25)23-15-19-7-3-4-8-20(19)16-24-13-5-2-6-14-24/h3-4,7-12H,2,5-6,13-17H2,1H3,(H,23,25)/p+1 |
| InChIKey | LBZYGQZLGRQCDE-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |