C23H31N2O2S+ — CID 8969620
2-(4-ethoxyphenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 8969620) has the molecular formula C23H31N2O2S+ and a molecular weight of 399.58 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-ethoxyphenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 8969620 |
| Molecular Formula | C23H31N2O2S+ |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-(4-ethoxyphenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | CCOc1ccc(SCC(=O)NCc2ccccc2C[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C23H30N2O2S/c1-2-27-21-10-12-22(13-11-21)28-18-23(26)24-16-19-8-4-5-9-20(19)17-25-14-6-3-7-15-25/h4-5,8-13H,2-3,6-7,14-18H2,1H3,(H,24,26)/p+1 |
| InChIKey | DXZBOQGJLZWKEO-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |