C23H31N2O3+ — CID 8545376
2-(4-ethoxyphenoxy)-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 8545376) has the molecular formula C23H31N2O3+ and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-ethoxyphenoxy)-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 8545376 |
| Molecular Formula | C23H31N2O3+ |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | CCOc1ccc(OCC(=O)NCc2ccc(C[NH+]3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H30N2O3/c1-2-27-21-10-12-22(13-11-21)28-18-23(26)24-16-19-6-8-20(9-7-19)17-25-14-4-3-5-15-25/h6-13H,2-5,14-18H2,1H3,(H,24,26)/p+1 |
| InChIKey | OOJQGBGJFCLIJE-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |