C21H26N3O3+ — CID 8533134
2-[2-oxo-2-[[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methylamino]ethoxy]benzamide (PubChem CID 8533134) has the molecular formula C21H26N3O3+ and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-[2-oxo-2-[[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methylamino]ethoxy]benzamide.
| Compound Name | 2-[2-oxo-2-[[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methylamino]ethoxy]benzamide |
|---|---|
| PubChem CID | 8533134 |
| Molecular Formula | C21H26N3O3+ |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-[2-oxo-2-[[4-(pyrrolidin-1-ium-1-ylmethyl)phenyl]methylamino]ethoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC(=O)NCc1ccc(C[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C21H25N3O3/c22-21(26)18-5-1-2-6-19(18)27-15-20(25)23-13-16-7-9-17(10-8-16)14-24-11-3-4-12-24/h1-2,5-10H,3-4,11-15H2,(H2,22,26)(H,23,25)/p+1 |
| InChIKey | JUPAZHOHIAXDKK-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |