C17H18N2O3S — CID 8529413
2-[2-oxo-2-(2-phenylsulfanylethylamino)ethoxy]benzamide (PubChem CID 8529413) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[2-oxo-2-(2-phenylsulfanylethylamino)ethoxy]benzamide.
| Compound Name | 2-[2-oxo-2-(2-phenylsulfanylethylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 8529413 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[2-oxo-2-(2-phenylsulfanylethylamino)ethoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC(=O)NCCSc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3S/c18-17(21)14-8-4-5-9-15(14)22-12-16(20)19-10-11-23-13-6-2-1-3-7-13/h1-9H,10-12H2,(H2,18,21)(H,19,20) |
| InChIKey | DSBLIIFGJQGVME-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|