C13H17N3O4S — CID 106237128
2-[2-[[2-(2-carbamothioylphenoxy)acetyl]amino]ethoxy]acetamide (PubChem CID 106237128) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-[2-[[2-(2-carbamothioylphenoxy)acetyl]amino]ethoxy]acetamide.
| Compound Name | 2-[2-[[2-(2-carbamothioylphenoxy)acetyl]amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106237128 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[2-[[2-(2-carbamothioylphenoxy)acetyl]amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNC(=O)COc1ccccc1C(N)=S |
| InChI | InChI=1S/C13H17N3O4S/c14-11(17)7-19-6-5-16-12(18)8-20-10-4-2-1-3-9(10)13(15)21/h1-4H,5-8H2,(H2,14,17)(H2,15,21)(H,16,18) |
| InChIKey | UACNHPSXHUAKBP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|