C14H19N3O4 — CID 9092419
2-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethoxy]benzamide (PubChem CID 9092419) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethoxy]benzamide.
| Compound Name | 2-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 9092419 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethoxy]benzamide |
| SMILES | CCCNC(=O)CNC(=O)COc1ccccc1C(N)=O |
| InChI | InChI=1S/C14H19N3O4/c1-2-7-16-12(18)8-17-13(19)9-21-11-6-4-3-5-10(11)14(15)20/h3-6H,2,7-9H2,1H3,(H2,15,20)(H,16,18)(H,17,19) |
| InChIKey | SFDZNAMVOGEOSS-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |