C16H17N3O5 — CID 9081252
2-[2-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]-2-oxoethoxy]benzamide (PubChem CID 9081252) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[2-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]-2-oxoethoxy]benzamide.
| Compound Name | 2-[2-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 9081252 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-[2-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC(=O)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H17N3O5/c17-16(22)12-5-1-2-6-13(12)24-10-15(21)19-9-14(20)18-8-11-4-3-7-23-11/h1-7H,8-10H2,(H2,17,22)(H,18,20)(H,19,21) |
| InChIKey | RHXODWRASFUODT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |