C20H17NO4 — CID 7229191
[2-(furan-2-ylmethylamino)-2-oxoethyl] 2-phenylbenzoate (PubChem CID 7229191) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-phenylbenzoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 7229191 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 2-phenylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1-c1ccccc1)NCc1ccco1 |
| InChI | InChI=1S/C20H17NO4/c22-19(21-13-16-9-6-12-24-16)14-25-20(23)18-11-5-4-10-17(18)15-7-2-1-3-8-15/h1-12H,13-14H2,(H,21,22) |
| InChIKey | DEHQRTHGPQBIDO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |