C10H12N2O3 — CID 2578374
2-[2-(methylamino)-2-oxoethoxy]benzamide (PubChem CID 2578374) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-[2-(methylamino)-2-oxoethoxy]benzamide.
| Compound Name | 2-[2-(methylamino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 2578374 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-[2-(methylamino)-2-oxoethoxy]benzamide |
| SMILES | CNC(=O)COc1ccccc1C(N)=O |
| InChI | InChI=1S/C10H12N2O3/c1-12-9(13)6-15-8-5-3-2-4-7(8)10(11)14/h2-5H,6H2,1H3,(H2,11,14)(H,12,13) |
| InChIKey | BWDAFEZJINGQQS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |