C12H15N3O5 — CID 106164586
2-[2-[(3-amino-2-hydroxy-3-oxopropyl)amino]-2-oxoethoxy]benzamide (PubChem CID 106164586) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-[2-[(3-amino-2-hydroxy-3-oxopropyl)amino]-2-oxoethoxy]benzamide.
| Compound Name | 2-[2-[(3-amino-2-hydroxy-3-oxopropyl)amino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 106164586 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[2-[(3-amino-2-hydroxy-3-oxopropyl)amino]-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C12H15N3O5/c13-11(18)7-3-1-2-4-9(7)20-6-10(17)15-5-8(16)12(14)19/h1-4,8,16H,5-6H2,(H2,13,18)(H2,14,19)(H,15,17) |
| InChIKey | WJGZXBAWAAYYCQ-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |