C15H20N2O4 — CID 43426354
2-[2-[(2-methyl-4-oxopentan-3-yl)amino]-2-oxoethoxy]benzamide (PubChem CID 43426354) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[2-[(2-methyl-4-oxopentan-3-yl)amino]-2-oxoethoxy]benzamide.
| Compound Name | 2-[2-[(2-methyl-4-oxopentan-3-yl)amino]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 43426354 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[2-[(2-methyl-4-oxopentan-3-yl)amino]-2-oxoethoxy]benzamide |
| SMILES | CC(=O)C(NC(=O)COc1ccccc1C(N)=O)C(C)C |
| InChI | InChI=1S/C15H20N2O4/c1-9(2)14(10(3)18)17-13(19)8-21-12-7-5-4-6-11(12)15(16)20/h4-7,9,14H,8H2,1-3H3,(H2,16,20)(H,17,19) |
| InChIKey | LTHTVWIOWVGTAB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |