C19H21NO4S — CID 9371413
ethyl 2-[2-oxo-2-(2-phenylsulfanylethylamino)ethoxy]benzoate (PubChem CID 9371413) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is ethyl 2-[2-oxo-2-(2-phenylsulfanylethylamino)ethoxy]benzoate.
| Compound Name | ethyl 2-[2-oxo-2-(2-phenylsulfanylethylamino)ethoxy]benzoate |
|---|---|
| PubChem CID | 9371413 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | ethyl 2-[2-oxo-2-(2-phenylsulfanylethylamino)ethoxy]benzoate |
| SMILES | CCOC(=O)c1ccccc1OCC(=O)NCCSc1ccccc1 |
| InChI | InChI=1S/C19H21NO4S/c1-2-23-19(22)16-10-6-7-11-17(16)24-14-18(21)20-12-13-25-15-8-4-3-5-9-15/h3-11H,2,12-14H2,1H3,(H,20,21) |
| InChIKey | CHTITUXFHTXNDP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|