C23H30N3O3+ — CID 9092886
2-[2-oxo-2-[4-[(4-propan-2-ylphenyl)methyl]piperazin-4-ium-1-yl]ethoxy]benzamide (PubChem CID 9092886) has the molecular formula C23H30N3O3+ and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-[2-oxo-2-[4-[(4-propan-2-ylphenyl)methyl]piperazin-4-ium-1-yl]ethoxy]benzamide.
| Compound Name | 2-[2-oxo-2-[4-[(4-propan-2-ylphenyl)methyl]piperazin-4-ium-1-yl]ethoxy]benzamide |
|---|---|
| PubChem CID | 9092886 |
| Molecular Formula | C23H30N3O3+ |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-[2-oxo-2-[4-[(4-propan-2-ylphenyl)methyl]piperazin-4-ium-1-yl]ethoxy]benzamide |
| SMILES | CC(C)c1ccc(C[NH+]2CCN(C(=O)COc3ccccc3C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-17(2)19-9-7-18(8-10-19)15-25-11-13-26(14-12-25)22(27)16-29-21-6-4-3-5-20(21)23(24)28/h3-10,17H,11-16H2,1-2H3,(H2,24,28)/p+1 |
| InChIKey | DXBNLHNVJJXABI-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |