C15H20N2O4 — CID 7283920
2-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethoxy]benzamide (PubChem CID 7283920) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 2-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethoxy]benzamide.
| Compound Name | 2-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 7283920 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethoxy]benzamide |
| SMILES | C[C@H]1CN(C(=O)COc2ccccc2C(N)=O)C[C@H](C)O1 |
| InChI | InChI=1S/C15H20N2O4/c1-10-7-17(8-11(2)21-10)14(18)9-20-13-6-4-3-5-12(13)15(16)19/h3-6,10-11H,7-9H2,1-2H3,(H2,16,19)/t10-,11-/m0/s1 |
| InChIKey | XEBXFNNYURXLIW-QWRGUYRKSA-N |
| XLogP | 0.80 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |