C20H22N2O4 — CID 95138688
4-[2-[(2R,6R)-2-methyl-6-phenylmorpholin-4-yl]-2-oxoethoxy]benzamide (PubChem CID 95138688) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-[2-[(2R,6R)-2-methyl-6-phenylmorpholin-4-yl]-2-oxoethoxy]benzamide.
| Compound Name | 4-[2-[(2R,6R)-2-methyl-6-phenylmorpholin-4-yl]-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 95138688 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-[2-[(2R,6R)-2-methyl-6-phenylmorpholin-4-yl]-2-oxoethoxy]benzamide |
| SMILES | C[C@@H]1CN(C(=O)COc2ccc(C(N)=O)cc2)C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C20H22N2O4/c1-14-11-22(12-18(26-14)15-5-3-2-4-6-15)19(23)13-25-17-9-7-16(8-10-17)20(21)24/h2-10,14,18H,11-13H2,1H3,(H2,21,24)/t14-,18+/m1/s1 |
| InChIKey | BTPQGMZRILNRJQ-KDOFPFPSSA-N |
| XLogP | 2.15 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |