C23H25N2O2S+ — CID 9180755
2-(2-phenylphenoxy)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]ethanone (PubChem CID 9180755) has the molecular formula C23H25N2O2S+ and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-(2-phenylphenoxy)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]ethanone.
| Compound Name | 2-(2-phenylphenoxy)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 9180755 |
| Molecular Formula | C23H25N2O2S+ |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-(2-phenylphenoxy)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]ethanone |
| SMILES | O=C(COc1ccccc1-c1ccccc1)N1CC[NH+](Cc2ccsc2)CC1 |
| InChI | InChI=1S/C23H24N2O2S/c26-23(25-13-11-24(12-14-25)16-19-10-15-28-18-19)17-27-22-9-5-4-8-21(22)20-6-2-1-3-7-20/h1-10,15,18H,11-14,16-17H2/p+1 |
| InChIKey | BVHLIUZHFNLVPD-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |