C18H22N3O2+ — CID 4742818
2-phenoxy-1-[4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]ethanone (PubChem CID 4742818) has the molecular formula C18H22N3O2+ and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-phenoxy-1-[4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]ethanone.
| Compound Name | 2-phenoxy-1-[4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 4742818 |
| Molecular Formula | C18H22N3O2+ |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-phenoxy-1-[4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]ethanone |
| SMILES | O=C(COc1ccccc1)N1CC[NH+](Cc2cccnc2)CC1 |
| InChI | InChI=1S/C18H21N3O2/c22-18(15-23-17-6-2-1-3-7-17)21-11-9-20(10-12-21)14-16-5-4-8-19-13-16/h1-8,13H,9-12,14-15H2/p+1 |
| InChIKey | SAYWUUGRJYOFCW-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |