C18H22N3O2+ — CID 4744231
(2-methoxyphenyl)-[4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]methanone (PubChem CID 4744231) has the molecular formula C18H22N3O2+ and a molecular weight of 312.39 g/mol. Its IUPAC name is (2-methoxyphenyl)-[4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]methanone.
| Compound Name | (2-methoxyphenyl)-[4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 4744231 |
| Molecular Formula | C18H22N3O2+ |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2-methoxyphenyl)-[4-(pyridin-3-ylmethyl)piperazin-4-ium-1-yl]methanone |
| SMILES | COc1ccccc1C(=O)N1CC[NH+](Cc2cccnc2)CC1 |
| InChI | InChI=1S/C18H21N3O2/c1-23-17-7-3-2-6-16(17)18(22)21-11-9-20(10-12-21)14-15-5-4-8-19-13-15/h2-8,13H,9-12,14H2,1H3/p+1 |
| InChIKey | VFGQTALCPPSTLM-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |