C18H21ClN3O2+ — CID 9226327
(5-chloro-2-methoxyphenyl)-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]methanone (PubChem CID 9226327) has the molecular formula C18H21ClN3O2+ and a molecular weight of 346.84 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]methanone.
| Compound Name | (5-chloro-2-methoxyphenyl)-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 9226327 |
| Molecular Formula | C18H21ClN3O2+ |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-[4-(pyridin-4-ylmethyl)piperazin-4-ium-1-yl]methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CC[NH+](Cc2ccncc2)CC1 |
| InChI | InChI=1S/C18H20ClN3O2/c1-24-17-3-2-15(19)12-16(17)18(23)22-10-8-21(9-11-22)13-14-4-6-20-7-5-14/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | WMHLUGHBEYQOFR-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |