C17H19ClN3O+ — CID 3561585
[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-pyridin-4-ylmethanone (PubChem CID 3561585) has the molecular formula C17H19ClN3O+ and a molecular weight of 316.81 g/mol. Its IUPAC name is [4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 3561585 |
| Molecular Formula | C17H19ClN3O+ |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CC[NH+](Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H18ClN3O/c18-16-3-1-2-14(12-16)13-20-8-10-21(11-9-20)17(22)15-4-6-19-7-5-15/h1-7,12H,8-11,13H2/p+1 |
| InChIKey | WLERWLQEZNBFNI-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |