C19H23ClN3O3S+ — CID 9092845
5-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-carbonyl]-2-methylbenzenesulfonamide (PubChem CID 9092845) has the molecular formula C19H23ClN3O3S+ and a molecular weight of 408.93 g/mol. Its IUPAC name is 5-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-carbonyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-carbonyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 9092845 |
| Molecular Formula | C19H23ClN3O3S+ |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 5-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-carbonyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CC[NH+](Cc3cccc(Cl)c3)CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H22ClN3O3S/c1-14-5-6-16(12-18(14)27(21,25)26)19(24)23-9-7-22(8-10-23)13-15-3-2-4-17(20)11-15/h2-6,11-12H,7-10,13H2,1H3,(H2,21,25,26)/p+1 |
| InChIKey | XIXXWPCPLINWLQ-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |