C19H19ClN3O+ — CID 8623891
4-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-carbonyl]benzonitrile (PubChem CID 8623891) has the molecular formula C19H19ClN3O+ and a molecular weight of 340.83 g/mol. Its IUPAC name is 4-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-carbonyl]benzonitrile.
| Compound Name | 4-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 8623891 |
| Molecular Formula | C19H19ClN3O+ |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-carbonyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CC[NH+](Cc3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H18ClN3O/c20-18-3-1-2-16(12-18)14-22-8-10-23(11-9-22)19(24)17-6-4-15(13-21)5-7-17/h1-7,12H,8-11,14H2/p+1 |
| InChIKey | CBAROGOWCZIRMW-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 48.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |