C23H24N5O+ — CID 9317550
4-[[4-(1-benzylpyrazole-4-carbonyl)piperazin-1-ium-1-yl]methyl]benzonitrile (PubChem CID 9317550) has the molecular formula C23H24N5O+ and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-[[4-(1-benzylpyrazole-4-carbonyl)piperazin-1-ium-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(1-benzylpyrazole-4-carbonyl)piperazin-1-ium-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 9317550 |
| Molecular Formula | C23H24N5O+ |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 4-[[4-(1-benzylpyrazole-4-carbonyl)piperazin-1-ium-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(C[NH+]2CCN(C(=O)c3cnn(Cc4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C23H23N5O/c24-14-19-6-8-21(9-7-19)16-26-10-12-27(13-11-26)23(29)22-15-25-28(18-22)17-20-4-2-1-3-5-20/h1-9,15,18H,10-13,16-17H2/p+1 |
| InChIKey | AMOFDQOYALMJPN-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 66.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |