C16H21N4O+ — CID 9041784
(4-benzylpiperazin-4-ium-1-yl)-(1-methylpyrazol-4-yl)methanone (PubChem CID 9041784) has the molecular formula C16H21N4O+ and a molecular weight of 285.37 g/mol. Its IUPAC name is (4-benzylpiperazin-4-ium-1-yl)-(1-methylpyrazol-4-yl)methanone.
| Compound Name | (4-benzylpiperazin-4-ium-1-yl)-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 9041784 |
| Molecular Formula | C16H21N4O+ |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (4-benzylpiperazin-4-ium-1-yl)-(1-methylpyrazol-4-yl)methanone |
| SMILES | Cn1cc(C(=O)N2CC[NH+](Cc3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C16H20N4O/c1-18-13-15(11-17-18)16(21)20-9-7-19(8-10-20)12-14-5-3-2-4-6-14/h2-6,11,13H,7-10,12H2,1H3/p+1 |
| InChIKey | CJKIZAVXZJINMC-UHFFFAOYSA-O |
| XLogP | -0.04 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |