C22H25N4O+ — CID 9041253
(4-benzhydrylpiperazin-4-ium-1-yl)-(1-methylpyrazol-4-yl)methanone (PubChem CID 9041253) has the molecular formula C22H25N4O+ and a molecular weight of 361.47 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-4-ium-1-yl)-(1-methylpyrazol-4-yl)methanone.
| Compound Name | (4-benzhydrylpiperazin-4-ium-1-yl)-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 9041253 |
| Molecular Formula | C22H25N4O+ |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (4-benzhydrylpiperazin-4-ium-1-yl)-(1-methylpyrazol-4-yl)methanone |
| SMILES | Cn1cc(C(=O)N2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C22H24N4O/c1-24-17-20(16-23-24)22(27)26-14-12-25(13-15-26)21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,16-17,21H,12-15H2,1H3/p+1 |
| InChIKey | LCHGWAWKSAOYPX-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |