C23H27N4O+ — CID 7221591
(4-benzhydrylpiperazin-4-ium-1-yl)-(1,5-dimethylpyrazol-3-yl)methanone (PubChem CID 7221591) has the molecular formula C23H27N4O+ and a molecular weight of 375.50 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-4-ium-1-yl)-(1,5-dimethylpyrazol-3-yl)methanone.
| Compound Name | (4-benzhydrylpiperazin-4-ium-1-yl)-(1,5-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 7221591 |
| Molecular Formula | C23H27N4O+ |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (4-benzhydrylpiperazin-4-ium-1-yl)-(1,5-dimethylpyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)nn1C |
| InChI | InChI=1S/C23H26N4O/c1-18-17-21(24-25(18)2)23(28)27-15-13-26(14-16-27)22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,17,22H,13-16H2,1-2H3/p+1 |
| InChIKey | SSGJAUSSGPIZEE-UHFFFAOYSA-O |
| XLogP | 1.86 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |