C28H29N2O2+ — CID 6979917
(4-benzhydrylpiperazin-4-ium-1-yl)-(3,5-dimethyl-1-benzofuran-2-yl)methanone (PubChem CID 6979917) has the molecular formula C28H29N2O2+ and a molecular weight of 425.55 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-4-ium-1-yl)-(3,5-dimethyl-1-benzofuran-2-yl)methanone.
| Compound Name | (4-benzhydrylpiperazin-4-ium-1-yl)-(3,5-dimethyl-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 6979917 |
| Molecular Formula | C28H29N2O2+ |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (4-benzhydrylpiperazin-4-ium-1-yl)-(3,5-dimethyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1ccc2oc(C(=O)N3CC[NH+](C(c4ccccc4)c4ccccc4)CC3)c(C)c2c1 |
| InChI | InChI=1S/C28H28N2O2/c1-20-13-14-25-24(19-20)21(2)27(32-25)28(31)30-17-15-29(16-18-30)26(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-14,19,26H,15-18H2,1-2H3/p+1 |
| InChIKey | CIRVSMFDWGCVHD-UHFFFAOYSA-O |
| XLogP | 4.18 |
| TPSA | 37.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |