C19H24N2O2 — CID 95749888
(3,5-dimethyl-1-benzofuran-2-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone (PubChem CID 95749888) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3,5-dimethyl-1-benzofuran-2-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone.
| Compound Name | (3,5-dimethyl-1-benzofuran-2-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 95749888 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3,5-dimethyl-1-benzofuran-2-yl)-(4-prop-2-enyl-1,4-diazepan-1-yl)methanone |
| SMILES | C=CCN1CCCN(C(=O)c2oc3ccc(C)cc3c2C)CC1 |
| InChI | InChI=1S/C19H24N2O2/c1-4-8-20-9-5-10-21(12-11-20)19(22)18-15(3)16-13-14(2)6-7-17(16)23-18/h4,6-7,13H,1,5,8-12H2,2-3H3 |
| InChIKey | NKKRBUPTGTVBKC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|