C19H24FNO2 — CID 144763857
(E)-but-2-ene;(5-fluoro-3-methyl-1-benzofuran-2-yl)-piperidin-1-ylmethanone (PubChem CID 144763857) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is (E)-but-2-ene;(5-fluoro-3-methyl-1-benzofuran-2-yl)-piperidin-1-ylmethanone.
| Compound Name | (E)-but-2-ene;(5-fluoro-3-methyl-1-benzofuran-2-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 144763857 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (E)-but-2-ene;(5-fluoro-3-methyl-1-benzofuran-2-yl)-piperidin-1-ylmethanone |
| SMILES | C/C=C/C.Cc1c(C(=O)N2CCCCC2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C15H16FNO2.C4H8/c1-10-12-9-11(16)5-6-13(12)19-14(10)15(18)17-7-3-2-4-8-17;1-3-4-2/h5-6,9H,2-4,7-8H2,1H3;3-4H,1-2H3/b;4-3+ |
| InChIKey | GBMMQHVEGKCEIX-SCBDLNNBSA-N |
| XLogP | 5.09 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|