About [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone
[(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone (PubChem CID 96537714) has the molecular formula C16H18FNO3S
and a molecular weight of 323.39 g/mol. Its IUPAC name is [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone.
Molecular Properties
| Compound Name | [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone |
| PubChem CID | 96537714 |
| Molecular Formula | C16H18FNO3S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CC[S@](=O)C(C)(C)C2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C16H18FNO3S/c1-10-12-8-11(17)4-5-13(12)21-14(10)15(19)18-6-7-22(20)16(2,3)9-18/h4-5,8H,6-7,9H2,1-3H3/t22-/m0/s1 |
| InChIKey | IBDQTGKDDIKAGV-QFIPXVFZSA-N |
| XLogP | 2.86 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
The IUPAC name of [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone (CID 96537714) is [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone.
What is the SMILES notation for [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
The canonical SMILES for [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone is Cc1c(C(=O)N2CC[S@](=O)C(C)(C)C2)oc2ccc(F)cc12.
What is the InChIKey of [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
The InChIKey is IBDQTGKDDIKAGV-QFIPXVFZSA-N. The full InChI is InChI=1S/C16H18FNO3S/c1-10-12-8-11(17)4-5-13(12)21-14(10)15(19)18-6-7-22(20)16(2,3)9-18/h4-5,8H,6-7,9H2,1-3H3/t22-/m0/s1.
What are the key properties of [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone?
[(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone has a molecular weight of 323.39 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]-(5-fluoro-3-methyl-1-benzofuran-2-yl)methanone is sourced from PubChem (CID 96537714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).