C21H20FNO2 — CID 24660150
(5-fluoro-3-methyl-1-benzofuran-2-yl)-(4-phenylpiperidin-1-yl)methanone (PubChem CID 24660150) has the molecular formula C21H20FNO2 and a molecular weight of 337.39 g/mol. Its IUPAC name is (5-fluoro-3-methyl-1-benzofuran-2-yl)-(4-phenylpiperidin-1-yl)methanone.
| Compound Name | (5-fluoro-3-methyl-1-benzofuran-2-yl)-(4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 24660150 |
| Molecular Formula | C21H20FNO2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (5-fluoro-3-methyl-1-benzofuran-2-yl)-(4-phenylpiperidin-1-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCC(c3ccccc3)CC2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C21H20FNO2/c1-14-18-13-17(22)7-8-19(18)25-20(14)21(24)23-11-9-16(10-12-23)15-5-3-2-4-6-15/h2-8,13,16H,9-12H2,1H3 |
| InChIKey | LGNXWTNJSYKOHI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |