C20H20N2O2 — CID 16676076
(3-methyl-1-benzofuran-2-yl)-(4-pyridin-4-ylpiperidin-1-yl)methanone (PubChem CID 16676076) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3-methyl-1-benzofuran-2-yl)-(4-pyridin-4-ylpiperidin-1-yl)methanone.
| Compound Name | (3-methyl-1-benzofuran-2-yl)-(4-pyridin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 16676076 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (3-methyl-1-benzofuran-2-yl)-(4-pyridin-4-ylpiperidin-1-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCC(c3ccncc3)CC2)oc2ccccc12 |
| InChI | InChI=1S/C20H20N2O2/c1-14-17-4-2-3-5-18(17)24-19(14)20(23)22-12-8-16(9-13-22)15-6-10-21-11-7-15/h2-7,10-11,16H,8-9,12-13H2,1H3 |
| InChIKey | YPELCZFAFHMTHP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |